C11H13BrO4S — CID 54970697
2-[(3-bromo-4-methoxyphenyl)methylsulfinyl]propanoic acid (PubChem CID 54970697) has the molecular formula C11H13BrO4S and a molecular weight of 321.19 g/mol. Its IUPAC name is 2-[(3-bromo-4-methoxyphenyl)methylsulfinyl]propanoic acid.
| Compound Name | 2-[(3-bromo-4-methoxyphenyl)methylsulfinyl]propanoic acid |
|---|---|
| PubChem CID | 54970697 |
| Molecular Formula | C11H13BrO4S |
| Molecular Weight | 321.19 g/mol |
| Exact Mass | 319.97 |
| IUPAC Name | 2-[(3-bromo-4-methoxyphenyl)methylsulfinyl]propanoic acid |
| SMILES | COc1ccc(CS(=O)C(C)C(=O)O)cc1Br |
| InChI | InChI=1S/C11H13BrO4S/c1-7(11(13)14)17(15)6-8-3-4-10(16-2)9(12)5-8/h3-5,7H,6H2,1-2H3,(H,13,14) |
| InChIKey | YCEOEHKXQLUWHS-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.19 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |