C11H17FN2O2S — CID 54973713
N-[(3-fluorophenyl)methyl]-N-methyl-2-(methylamino)ethanesulfonamide (PubChem CID 54973713) has the molecular formula C11H17FN2O2S and a molecular weight of 260.33 g/mol. Its IUPAC name is N-[(3-fluorophenyl)methyl]-N-methyl-2-(methylamino)ethanesulfonamide.
| Compound Name | N-[(3-fluorophenyl)methyl]-N-methyl-2-(methylamino)ethanesulfonamide |
|---|---|
| PubChem CID | 54973713 |
| Molecular Formula | C11H17FN2O2S |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | N-[(3-fluorophenyl)methyl]-N-methyl-2-(methylamino)ethanesulfonamide |
| SMILES | CNCCS(=O)(=O)N(C)Cc1cccc(F)c1 |
| InChI | InChI=1S/C11H17FN2O2S/c1-13-6-7-17(15,16)14(2)9-10-4-3-5-11(12)8-10/h3-5,8,13H,6-7,9H2,1-2H3 |
| InChIKey | ZXYXMMPZXZCRAV-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |