About methyl 2-[(1,5-dimethylpyrrole-2-carbonyl)-ethylamino]acetate
methyl 2-[(1,5-dimethylpyrrole-2-carbonyl)-ethylamino]acetate (PubChem CID 54979060) has the molecular formula C12H18N2O3
and a molecular weight of 238.29 g/mol. Its IUPAC name is methyl 2-[(1,5-dimethylpyrrole-2-carbonyl)-ethylamino]acetate.
Analyze methyl 2-[(1,5-dimethylpyrrole-2-carbonyl)-ethylamino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(1,5-dimethylpyrrole-2-carbonyl)-ethylamino]acetate?
The IUPAC name of methyl 2-[(1,5-dimethylpyrrole-2-carbonyl)-ethylamino]acetate (CID 54979060) is methyl 2-[(1,5-dimethylpyrrole-2-carbonyl)-ethylamino]acetate.
What is the SMILES notation for methyl 2-[(1,5-dimethylpyrrole-2-carbonyl)-ethylamino]acetate?
The canonical SMILES for methyl 2-[(1,5-dimethylpyrrole-2-carbonyl)-ethylamino]acetate is CCN(CC(=O)OC)C(=O)c1ccc(C)n1C.
What is the InChIKey of methyl 2-[(1,5-dimethylpyrrole-2-carbonyl)-ethylamino]acetate?
The InChIKey is GFUCJAYFHPQWCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O3/c1-5-14(8-11(15)17-4)12(16)10-7-6-9(2)13(10)3/h6-7H,5,8H2,1-4H3.
What are the key properties of methyl 2-[(1,5-dimethylpyrrole-2-carbonyl)-ethylamino]acetate?
methyl 2-[(1,5-dimethylpyrrole-2-carbonyl)-ethylamino]acetate has a molecular weight of 238.29 g/mol, XLogP of 0.97, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(1,5-dimethylpyrrole-2-carbonyl)-ethylamino]acetate is sourced from PubChem (CID 54979060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).