C14H20N2O3 — CID 113331339
ethyl 2-[(1,5-dimethylpyrrole-2-carbonyl)-prop-2-enylamino]acetate (PubChem CID 113331339) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is ethyl 2-[(1,5-dimethylpyrrole-2-carbonyl)-prop-2-enylamino]acetate.
| Compound Name | ethyl 2-[(1,5-dimethylpyrrole-2-carbonyl)-prop-2-enylamino]acetate |
|---|---|
| PubChem CID | 113331339 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | ethyl 2-[(1,5-dimethylpyrrole-2-carbonyl)-prop-2-enylamino]acetate |
| SMILES | C=CCN(CC(=O)OCC)C(=O)c1ccc(C)n1C |
| InChI | InChI=1S/C14H20N2O3/c1-5-9-16(10-13(17)19-6-2)14(18)12-8-7-11(3)15(12)4/h5,7-8H,1,6,9-10H2,2-4H3 |
| InChIKey | AVIJSVICUNVHDF-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|