C14H21N3O3 — CID 115538810
ethyl 2-[(3-ethyl-1-methylpyrazole-5-carbonyl)-prop-2-enylamino]acetate (PubChem CID 115538810) has the molecular formula C14H21N3O3 and a molecular weight of 279.34 g/mol. Its IUPAC name is ethyl 2-[(3-ethyl-1-methylpyrazole-5-carbonyl)-prop-2-enylamino]acetate.
| Compound Name | ethyl 2-[(3-ethyl-1-methylpyrazole-5-carbonyl)-prop-2-enylamino]acetate |
|---|---|
| PubChem CID | 115538810 |
| Molecular Formula | C14H21N3O3 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | ethyl 2-[(3-ethyl-1-methylpyrazole-5-carbonyl)-prop-2-enylamino]acetate |
| SMILES | C=CCN(CC(=O)OCC)C(=O)c1cc(CC)nn1C |
| InChI | InChI=1S/C14H21N3O3/c1-5-8-17(10-13(18)20-7-3)14(19)12-9-11(6-2)15-16(12)4/h5,9H,1,6-8,10H2,2-4H3 |
| InChIKey | UAMIBQLVGZCSSV-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|