C12H18N2O5 — CID 54980303
methyl 3-[3-(2,5-dioxopyrrolidin-1-yl)propanoyl-methylamino]propanoate (PubChem CID 54980303) has the molecular formula C12H18N2O5 and a molecular weight of 270.28 g/mol. Its IUPAC name is methyl 3-[3-(2,5-dioxopyrrolidin-1-yl)propanoyl-methylamino]propanoate.
| Compound Name | methyl 3-[3-(2,5-dioxopyrrolidin-1-yl)propanoyl-methylamino]propanoate |
|---|---|
| PubChem CID | 54980303 |
| Molecular Formula | C12H18N2O5 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | methyl 3-[3-(2,5-dioxopyrrolidin-1-yl)propanoyl-methylamino]propanoate |
| SMILES | COC(=O)CCN(C)C(=O)CCN1C(=O)CCC1=O |
| InChI | InChI=1S/C12H18N2O5/c1-13(7-6-12(18)19-2)9(15)5-8-14-10(16)3-4-11(14)17/h3-8H2,1-2H3 |
| InChIKey | WNIJUUKXOGHVSP-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|