C9H19N5O2S — CID 54982746
4-[[[3-aminopropyl(methyl)sulfamoyl]amino]methyl]-5-methyl-1H-pyrazole (PubChem CID 54982746) has the molecular formula C9H19N5O2S and a molecular weight of 261.35 g/mol. Its IUPAC name is 4-[[[3-aminopropyl(methyl)sulfamoyl]amino]methyl]-5-methyl-1H-pyrazole.
| Compound Name | 4-[[[3-aminopropyl(methyl)sulfamoyl]amino]methyl]-5-methyl-1H-pyrazole |
|---|---|
| PubChem CID | 54982746 |
| Molecular Formula | C9H19N5O2S |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 4-[[[3-aminopropyl(methyl)sulfamoyl]amino]methyl]-5-methyl-1H-pyrazole |
| SMILES | Cc1[nH]ncc1CNS(=O)(=O)N(C)CCCN |
| InChI | InChI=1S/C9H19N5O2S/c1-8-9(6-11-13-8)7-12-17(15,16)14(2)5-3-4-10/h6,12H,3-5,7,10H2,1-2H3,(H,11,13) |
| InChIKey | RVRHWRZHMGVTCO-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |