C14H17N3O2 — CID 54997374
methyl 5-amino-2-[2-cyanoethyl(cyclopropyl)amino]benzoate (PubChem CID 54997374) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is methyl 5-amino-2-[2-cyanoethyl(cyclopropyl)amino]benzoate.
| Compound Name | methyl 5-amino-2-[2-cyanoethyl(cyclopropyl)amino]benzoate |
|---|---|
| PubChem CID | 54997374 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | methyl 5-amino-2-[2-cyanoethyl(cyclopropyl)amino]benzoate |
| SMILES | COC(=O)c1cc(N)ccc1N(CCC#N)C1CC1 |
| InChI | InChI=1S/C14H17N3O2/c1-19-14(18)12-9-10(16)3-6-13(12)17(8-2-7-15)11-4-5-11/h3,6,9,11H,2,4-5,8,16H2,1H3 |
| InChIKey | DLXSGQFPTMEOSI-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 79.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|