C13H16N4O — CID 61126513
2,4-diamino-N-(2-cyanoethyl)-N-cyclopropylbenzamide (PubChem CID 61126513) has the molecular formula C13H16N4O and a molecular weight of 244.30 g/mol. Its IUPAC name is 2,4-diamino-N-(2-cyanoethyl)-N-cyclopropylbenzamide.
| Compound Name | 2,4-diamino-N-(2-cyanoethyl)-N-cyclopropylbenzamide |
|---|---|
| PubChem CID | 61126513 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 2,4-diamino-N-(2-cyanoethyl)-N-cyclopropylbenzamide |
| SMILES | N#CCCN(C(=O)c1ccc(N)cc1N)C1CC1 |
| InChI | InChI=1S/C13H16N4O/c14-6-1-7-17(10-3-4-10)13(18)11-5-2-9(15)8-12(11)16/h2,5,8,10H,1,3-4,7,15-16H2 |
| InChIKey | YOADXRWCMWDEAM-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 96.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|