C14H21BFNO2 — CID 55000677
[5-[[cyclopropylmethyl(propan-2-yl)amino]methyl]-2-fluorophenyl]boronic acid (PubChem CID 55000677) has the molecular formula C14H21BFNO2 and a molecular weight of 265.14 g/mol. Its IUPAC name is [5-[[cyclopropylmethyl(propan-2-yl)amino]methyl]-2-fluorophenyl]boronic acid.
| Compound Name | [5-[[cyclopropylmethyl(propan-2-yl)amino]methyl]-2-fluorophenyl]boronic acid |
|---|---|
| PubChem CID | 55000677 |
| Molecular Formula | C14H21BFNO2 |
| Molecular Weight | 265.14 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | [5-[[cyclopropylmethyl(propan-2-yl)amino]methyl]-2-fluorophenyl]boronic acid |
| SMILES | CC(C)N(Cc1ccc(F)c(B(O)O)c1)CC1CC1 |
| InChI | InChI=1S/C14H21BFNO2/c1-10(2)17(8-11-3-4-11)9-12-5-6-14(16)13(7-12)15(18)19/h5-7,10-11,18-19H,3-4,8-9H2,1-2H3 |
| InChIKey | UPARRMIHVBESMZ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.14 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|