C14H23BFNO2 — CID 55009091
[5-[[3,3-dimethylbutan-2-yl(methyl)amino]methyl]-2-fluorophenyl]boronic acid (PubChem CID 55009091) has the molecular formula C14H23BFNO2 and a molecular weight of 267.15 g/mol. Its IUPAC name is [5-[[3,3-dimethylbutan-2-yl(methyl)amino]methyl]-2-fluorophenyl]boronic acid.
| Compound Name | [5-[[3,3-dimethylbutan-2-yl(methyl)amino]methyl]-2-fluorophenyl]boronic acid |
|---|---|
| PubChem CID | 55009091 |
| Molecular Formula | C14H23BFNO2 |
| Molecular Weight | 267.15 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | [5-[[3,3-dimethylbutan-2-yl(methyl)amino]methyl]-2-fluorophenyl]boronic acid |
| SMILES | CC(N(C)Cc1ccc(F)c(B(O)O)c1)C(C)(C)C |
| InChI | InChI=1S/C14H23BFNO2/c1-10(14(2,3)4)17(5)9-11-6-7-13(16)12(8-11)15(18)19/h6-8,10,18-19H,9H2,1-5H3 |
| InChIKey | CNICURDUCOIGAU-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.15 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|