C15H19BFNO2S — CID 79489167
[2-fluoro-5-[[methyl(1-thiophen-2-ylpropan-2-yl)amino]methyl]phenyl]boronic acid (PubChem CID 79489167) has the molecular formula C15H19BFNO2S and a molecular weight of 307.20 g/mol. Its IUPAC name is [2-fluoro-5-[[methyl(1-thiophen-2-ylpropan-2-yl)amino]methyl]phenyl]boronic acid.
| Compound Name | [2-fluoro-5-[[methyl(1-thiophen-2-ylpropan-2-yl)amino]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 79489167 |
| Molecular Formula | C15H19BFNO2S |
| Molecular Weight | 307.20 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | [2-fluoro-5-[[methyl(1-thiophen-2-ylpropan-2-yl)amino]methyl]phenyl]boronic acid |
| SMILES | CC(Cc1cccs1)N(C)Cc1ccc(F)c(B(O)O)c1 |
| InChI | InChI=1S/C15H19BFNO2S/c1-11(8-13-4-3-7-21-13)18(2)10-12-5-6-15(17)14(9-12)16(19)20/h3-7,9,11,19-20H,8,10H2,1-2H3 |
| InChIKey | GRRHXYWYJWIYLI-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.20 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|