C15H20BNO2S — CID 79486657
[2-[[methyl(1-thiophen-2-ylpropan-2-yl)amino]methyl]phenyl]boronic acid (PubChem CID 79486657) has the molecular formula C15H20BNO2S and a molecular weight of 289.21 g/mol. Its IUPAC name is [2-[[methyl(1-thiophen-2-ylpropan-2-yl)amino]methyl]phenyl]boronic acid.
| Compound Name | [2-[[methyl(1-thiophen-2-ylpropan-2-yl)amino]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 79486657 |
| Molecular Formula | C15H20BNO2S |
| Molecular Weight | 289.21 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | [2-[[methyl(1-thiophen-2-ylpropan-2-yl)amino]methyl]phenyl]boronic acid |
| SMILES | CC(Cc1cccs1)N(C)Cc1ccccc1B(O)O |
| InChI | InChI=1S/C15H20BNO2S/c1-12(10-14-7-5-9-20-14)17(2)11-13-6-3-4-8-15(13)16(18)19/h3-9,12,18-19H,10-11H2,1-2H3 |
| InChIKey | HOXQCZDVVHPFSN-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.21 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|