C10H20F3N3O — CID 55002752
2-[(4-amino-1,1,1-trifluorobutan-2-yl)-butylamino]acetamide (PubChem CID 55002752) has the molecular formula C10H20F3N3O and a molecular weight of 255.28 g/mol. Its IUPAC name is 2-[(4-amino-1,1,1-trifluorobutan-2-yl)-butylamino]acetamide.
| Compound Name | 2-[(4-amino-1,1,1-trifluorobutan-2-yl)-butylamino]acetamide |
|---|---|
| PubChem CID | 55002752 |
| Molecular Formula | C10H20F3N3O |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 2-[(4-amino-1,1,1-trifluorobutan-2-yl)-butylamino]acetamide |
| SMILES | CCCCN(CC(N)=O)C(CCN)C(F)(F)F |
| InChI | InChI=1S/C10H20F3N3O/c1-2-3-6-16(7-9(15)17)8(4-5-14)10(11,12)13/h8H,2-7,14H2,1H3,(H2,15,17) |
| InChIKey | OOAKZXFQRBHEBH-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |