C12H20N2O4 — CID 55008721
(E)-4-[[3,3-dimethylbutan-2-yl(methyl)carbamoyl]amino]-4-oxobut-2-enoic acid (PubChem CID 55008721) has the molecular formula C12H20N2O4 and a molecular weight of 256.30 g/mol. Its IUPAC name is (E)-4-[[3,3-dimethylbutan-2-yl(methyl)carbamoyl]amino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[[3,3-dimethylbutan-2-yl(methyl)carbamoyl]amino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 55008721 |
| Molecular Formula | C12H20N2O4 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | (E)-4-[[3,3-dimethylbutan-2-yl(methyl)carbamoyl]amino]-4-oxobut-2-enoic acid |
| SMILES | CC(N(C)C(=O)NC(=O)/C=C/C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C12H20N2O4/c1-8(12(2,3)4)14(5)11(18)13-9(15)6-7-10(16)17/h6-8H,1-5H3,(H,16,17)(H,13,15,18)/b7-6+ |
| InChIKey | FSYIJSHWDAKCOQ-VOTSOKGWSA-N |
| XLogP | 1.23 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|