C11H22N2O — CID 95351070
1-[(2S)-3,3-dimethylbutan-2-yl]-1-methyl-3-prop-2-enylurea (PubChem CID 95351070) has the molecular formula C11H22N2O and a molecular weight of 198.31 g/mol. Its IUPAC name is 1-[(2S)-3,3-dimethylbutan-2-yl]-1-methyl-3-prop-2-enylurea.
| Compound Name | 1-[(2S)-3,3-dimethylbutan-2-yl]-1-methyl-3-prop-2-enylurea |
|---|---|
| PubChem CID | 95351070 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | 1-[(2S)-3,3-dimethylbutan-2-yl]-1-methyl-3-prop-2-enylurea |
| SMILES | C=CCNC(=O)N(C)[C@@H](C)C(C)(C)C |
| InChI | InChI=1S/C11H22N2O/c1-7-8-12-10(14)13(6)9(2)11(3,4)5/h7,9H,1,8H2,2-6H3,(H,12,14)/t9-/m0/s1 |
| InChIKey | UWOIWEYNCIPHLK-VIFPVBQESA-N |
| XLogP | 2.25 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|