C14H20FNO2S — CID 55018705
methyl 3-[2-amino-1-(2-fluorophenyl)butyl]sulfanylpropanoate (PubChem CID 55018705) has the molecular formula C14H20FNO2S and a molecular weight of 285.38 g/mol. Its IUPAC name is methyl 3-[2-amino-1-(2-fluorophenyl)butyl]sulfanylpropanoate.
| Compound Name | methyl 3-[2-amino-1-(2-fluorophenyl)butyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 55018705 |
| Molecular Formula | C14H20FNO2S |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | methyl 3-[2-amino-1-(2-fluorophenyl)butyl]sulfanylpropanoate |
| SMILES | CCC(N)C(SCCC(=O)OC)c1ccccc1F |
| InChI | InChI=1S/C14H20FNO2S/c1-3-12(16)14(19-9-8-13(17)18-2)10-6-4-5-7-11(10)15/h4-7,12,14H,3,8-9,16H2,1-2H3 |
| InChIKey | UZFROZBWNQWROK-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |