C14H21NO2S — CID 55019062
methyl 2-[2-amino-1-(2-methylphenyl)butyl]sulfanylacetate (PubChem CID 55019062) has the molecular formula C14H21NO2S and a molecular weight of 267.39 g/mol. Its IUPAC name is methyl 2-[2-amino-1-(2-methylphenyl)butyl]sulfanylacetate.
| Compound Name | methyl 2-[2-amino-1-(2-methylphenyl)butyl]sulfanylacetate |
|---|---|
| PubChem CID | 55019062 |
| Molecular Formula | C14H21NO2S |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | methyl 2-[2-amino-1-(2-methylphenyl)butyl]sulfanylacetate |
| SMILES | CCC(N)C(SCC(=O)OC)c1ccccc1C |
| InChI | InChI=1S/C14H21NO2S/c1-4-12(15)14(18-9-13(16)17-3)11-8-6-5-7-10(11)2/h5-8,12,14H,4,9,15H2,1-3H3 |
| InChIKey | FVKCIIAKCKUICC-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |