C10H15N3O4 — CID 55024386
N-[2-(2-hydroxyethoxy)ethyl]-2-(2-oxopyrimidin-1-yl)acetamide (PubChem CID 55024386) has the molecular formula C10H15N3O4 and a molecular weight of 241.25 g/mol. Its IUPAC name is N-[2-(2-hydroxyethoxy)ethyl]-2-(2-oxopyrimidin-1-yl)acetamide.
| Compound Name | N-[2-(2-hydroxyethoxy)ethyl]-2-(2-oxopyrimidin-1-yl)acetamide |
|---|---|
| PubChem CID | 55024386 |
| Molecular Formula | C10H15N3O4 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | N-[2-(2-hydroxyethoxy)ethyl]-2-(2-oxopyrimidin-1-yl)acetamide |
| SMILES | O=C(Cn1cccnc1=O)NCCOCCO |
| InChI | InChI=1S/C10H15N3O4/c14-5-7-17-6-3-11-9(15)8-13-4-1-2-12-10(13)16/h1-2,4,14H,3,5-8H2,(H,11,15) |
| InChIKey | ZMIQTCLZQIAMPJ-UHFFFAOYSA-N |
| XLogP | -1.63 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|