C14H11BrF2OS — CID 55027206
2-[2-(4-bromophenoxy)ethylsulfanyl]-1,4-difluorobenzene (PubChem CID 55027206) has the molecular formula C14H11BrF2OS and a molecular weight of 345.21 g/mol. Its IUPAC name is 2-[2-(4-bromophenoxy)ethylsulfanyl]-1,4-difluorobenzene.
| Compound Name | 2-[2-(4-bromophenoxy)ethylsulfanyl]-1,4-difluorobenzene |
|---|---|
| PubChem CID | 55027206 |
| Molecular Formula | C14H11BrF2OS |
| Molecular Weight | 345.21 g/mol |
| Exact Mass | 343.97 |
| IUPAC Name | 2-[2-(4-bromophenoxy)ethylsulfanyl]-1,4-difluorobenzene |
| SMILES | Fc1ccc(F)c(SCCOc2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C14H11BrF2OS/c15-10-1-4-12(5-2-10)18-7-8-19-14-9-11(16)3-6-13(14)17/h1-6,9H,7-8H2 |
| InChIKey | OODHCSVBQCPXLL-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.21 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|