C12H13BrN4OS — CID 4788587
2-[2-(4-bromophenoxy)ethylsulfanyl]pyrimidine-4,6-diamine (PubChem CID 4788587) has the molecular formula C12H13BrN4OS and a molecular weight of 341.23 g/mol. Its IUPAC name is 2-[2-(4-bromophenoxy)ethylsulfanyl]pyrimidine-4,6-diamine.
| Compound Name | 2-[2-(4-bromophenoxy)ethylsulfanyl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 4788587 |
| Molecular Formula | C12H13BrN4OS |
| Molecular Weight | 341.23 g/mol |
| Exact Mass | 340.00 |
| IUPAC Name | 2-[2-(4-bromophenoxy)ethylsulfanyl]pyrimidine-4,6-diamine |
| SMILES | Nc1cc(N)nc(SCCOc2ccc(Br)cc2)n1 |
| InChI | InChI=1S/C12H13BrN4OS/c13-8-1-3-9(4-2-8)18-5-6-19-12-16-10(14)7-11(15)17-12/h1-4,7H,5-6H2,(H4,14,15,16,17) |
| InChIKey | PERUDJSUJHNYMR-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.23 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|