C14H15N5OS — CID 60565233
2-[4-[2-(4,6-diaminopyrimidin-2-yl)sulfanylethoxy]phenyl]acetonitrile (PubChem CID 60565233) has the molecular formula C14H15N5OS and a molecular weight of 301.38 g/mol. Its IUPAC name is 2-[4-[2-(4,6-diaminopyrimidin-2-yl)sulfanylethoxy]phenyl]acetonitrile.
| Compound Name | 2-[4-[2-(4,6-diaminopyrimidin-2-yl)sulfanylethoxy]phenyl]acetonitrile |
|---|---|
| PubChem CID | 60565233 |
| Molecular Formula | C14H15N5OS |
| Molecular Weight | 301.38 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 2-[4-[2-(4,6-diaminopyrimidin-2-yl)sulfanylethoxy]phenyl]acetonitrile |
| SMILES | N#CCc1ccc(OCCSc2nc(N)cc(N)n2)cc1 |
| InChI | InChI=1S/C14H15N5OS/c15-6-5-10-1-3-11(4-2-10)20-7-8-21-14-18-12(16)9-13(17)19-14/h1-4,9H,5,7-8H2,(H4,16,17,18,19) |
| InChIKey | IRLONDRRZVIANZ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 110.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.38 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|