About 1-cyano-N-(2,2-dimethylcyclopropyl)cyclopentane-1-carboxamide
1-cyano-N-(2,2-dimethylcyclopropyl)cyclopentane-1-carboxamide (PubChem CID 55031136) has the molecular formula C12H18N2O
and a molecular weight of 206.29 g/mol. Its IUPAC name is 1-cyano-N-(2,2-dimethylcyclopropyl)cyclopentane-1-carboxamide.
Molecular Properties
| Compound Name | 1-cyano-N-(2,2-dimethylcyclopropyl)cyclopentane-1-carboxamide |
| PubChem CID | 55031136 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 1-cyano-N-(2,2-dimethylcyclopropyl)cyclopentane-1-carboxamide |
| SMILES | CC1(C)CC1NC(=O)C1(C#N)CCCC1 |
| InChI | InChI=1S/C12H18N2O/c1-11(2)7-9(11)14-10(15)12(8-13)5-3-4-6-12/h9H,3-7H2,1-2H3,(H,14,15) |
| InChIKey | BBJCIKHZMVNIRY-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-cyano-N-(2,2-dimethylcyclopropyl)cyclopentane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyano-N-(2,2-dimethylcyclopropyl)cyclopentane-1-carboxamide?
The IUPAC name of 1-cyano-N-(2,2-dimethylcyclopropyl)cyclopentane-1-carboxamide (CID 55031136) is 1-cyano-N-(2,2-dimethylcyclopropyl)cyclopentane-1-carboxamide.
What is the SMILES notation for 1-cyano-N-(2,2-dimethylcyclopropyl)cyclopentane-1-carboxamide?
The canonical SMILES for 1-cyano-N-(2,2-dimethylcyclopropyl)cyclopentane-1-carboxamide is CC1(C)CC1NC(=O)C1(C#N)CCCC1.
What is the InChIKey of 1-cyano-N-(2,2-dimethylcyclopropyl)cyclopentane-1-carboxamide?
The InChIKey is BBJCIKHZMVNIRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O/c1-11(2)7-9(11)14-10(15)12(8-13)5-3-4-6-12/h9H,3-7H2,1-2H3,(H,14,15).
What are the key properties of 1-cyano-N-(2,2-dimethylcyclopropyl)cyclopentane-1-carboxamide?
1-cyano-N-(2,2-dimethylcyclopropyl)cyclopentane-1-carboxamide has a molecular weight of 206.29 g/mol, XLogP of 1.99, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyano-N-(2,2-dimethylcyclopropyl)cyclopentane-1-carboxamide is sourced from PubChem (CID 55031136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).