C12H20N2O3S2 — CID 55033280
5-(2-aminoethyl)-N-(2-methoxycyclopentyl)thiophene-2-sulfonamide (PubChem CID 55033280) has the molecular formula C12H20N2O3S2 and a molecular weight of 304.44 g/mol. Its IUPAC name is 5-(2-aminoethyl)-N-(2-methoxycyclopentyl)thiophene-2-sulfonamide.
| Compound Name | 5-(2-aminoethyl)-N-(2-methoxycyclopentyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 55033280 |
| Molecular Formula | C12H20N2O3S2 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 5-(2-aminoethyl)-N-(2-methoxycyclopentyl)thiophene-2-sulfonamide |
| SMILES | COC1CCCC1NS(=O)(=O)c1ccc(CCN)s1 |
| InChI | InChI=1S/C12H20N2O3S2/c1-17-11-4-2-3-10(11)14-19(15,16)12-6-5-9(18-12)7-8-13/h5-6,10-11,14H,2-4,7-8,13H2,1H3 |
| InChIKey | QXCFPOLPLCLCHW-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |