C13H21NO3S2 — CID 97108846
N-[(1R,2R)-2-methoxycyclohexyl]-4,5-dimethylthiophene-2-sulfonamide (PubChem CID 97108846) has the molecular formula C13H21NO3S2 and a molecular weight of 303.45 g/mol. Its IUPAC name is N-[(1R,2R)-2-methoxycyclohexyl]-4,5-dimethylthiophene-2-sulfonamide.
| Compound Name | N-[(1R,2R)-2-methoxycyclohexyl]-4,5-dimethylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 97108846 |
| Molecular Formula | C13H21NO3S2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | N-[(1R,2R)-2-methoxycyclohexyl]-4,5-dimethylthiophene-2-sulfonamide |
| SMILES | CO[C@@H]1CCCC[C@H]1NS(=O)(=O)c1cc(C)c(C)s1 |
| InChI | InChI=1S/C13H21NO3S2/c1-9-8-13(18-10(9)2)19(15,16)14-11-6-4-5-7-12(11)17-3/h8,11-12,14H,4-7H2,1-3H3/t11-,12-/m1/s1 |
| InChIKey | RJHCMXQNCRJQTG-VXGBXAGGSA-N |
| XLogP | 2.60 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |