About 5-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-3-propyl-1,2,4-oxadiazole
5-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-3-propyl-1,2,4-oxadiazole (PubChem CID 55038851) has the molecular formula C11H15BrN4O
and a molecular weight of 299.17 g/mol. Its IUPAC name is 5-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-3-propyl-1,2,4-oxadiazole.
Molecular Properties
| Compound Name | 5-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-3-propyl-1,2,4-oxadiazole |
| PubChem CID | 55038851 |
| Molecular Formula | C11H15BrN4O |
| Molecular Weight | 299.17 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 5-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-3-propyl-1,2,4-oxadiazole |
| SMILES | CCCc1noc(Cn2nc(C)c(Br)c2C)n1 |
| InChI | InChI=1S/C11H15BrN4O/c1-4-5-9-13-10(17-15-9)6-16-8(3)11(12)7(2)14-16/h4-6H2,1-3H3 |
| InChIKey | XXVCZPCTGQYYSM-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.17 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-3-propyl-1,2,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-3-propyl-1,2,4-oxadiazole?
The IUPAC name of 5-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-3-propyl-1,2,4-oxadiazole (CID 55038851) is 5-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-3-propyl-1,2,4-oxadiazole.
What is the SMILES notation for 5-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-3-propyl-1,2,4-oxadiazole?
The canonical SMILES for 5-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-3-propyl-1,2,4-oxadiazole is CCCc1noc(Cn2nc(C)c(Br)c2C)n1.
What is the InChIKey of 5-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-3-propyl-1,2,4-oxadiazole?
The InChIKey is XXVCZPCTGQYYSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15BrN4O/c1-4-5-9-13-10(17-15-9)6-16-8(3)11(12)7(2)14-16/h4-6H2,1-3H3.
What are the key properties of 5-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-3-propyl-1,2,4-oxadiazole?
5-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-3-propyl-1,2,4-oxadiazole has a molecular weight of 299.17 g/mol, XLogP of 2.65, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-3-propyl-1,2,4-oxadiazole is sourced from PubChem (CID 55038851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).