C11H8F2N4O — CID 55041797
6-amino-N-(2,3-difluorophenyl)pyridazine-3-carboxamide (PubChem CID 55041797) has the molecular formula C11H8F2N4O and a molecular weight of 250.21 g/mol. Its IUPAC name is 6-amino-N-(2,3-difluorophenyl)pyridazine-3-carboxamide.
| Compound Name | 6-amino-N-(2,3-difluorophenyl)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 55041797 |
| Molecular Formula | C11H8F2N4O |
| Molecular Weight | 250.21 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | 6-amino-N-(2,3-difluorophenyl)pyridazine-3-carboxamide |
| SMILES | Nc1ccc(C(=O)Nc2cccc(F)c2F)nn1 |
| InChI | InChI=1S/C11H8F2N4O/c12-6-2-1-3-7(10(6)13)15-11(18)8-4-5-9(14)17-16-8/h1-5H,(H2,14,17)(H,15,18) |
| InChIKey | SYXWWYMBBNJCFJ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.21 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |