C11H8F2N2OS — CID 47450900
N-(2,3-difluorophenyl)-2-methyl-1,3-thiazole-4-carboxamide (PubChem CID 47450900) has the molecular formula C11H8F2N2OS and a molecular weight of 254.26 g/mol. Its IUPAC name is N-(2,3-difluorophenyl)-2-methyl-1,3-thiazole-4-carboxamide.
| Compound Name | N-(2,3-difluorophenyl)-2-methyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 47450900 |
| Molecular Formula | C11H8F2N2OS |
| Molecular Weight | 254.26 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | N-(2,3-difluorophenyl)-2-methyl-1,3-thiazole-4-carboxamide |
| SMILES | Cc1nc(C(=O)Nc2cccc(F)c2F)cs1 |
| InChI | InChI=1S/C11H8F2N2OS/c1-6-14-9(5-17-6)11(16)15-8-4-2-3-7(12)10(8)13/h2-5H,1H3,(H,15,16) |
| InChIKey | MRVUNWTWOYQHBK-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.26 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |