C11H17N3O3S — CID 55043942
2-(methylamino)-N-(oxolan-2-ylmethyl)pyridine-4-sulfonamide (PubChem CID 55043942) has the molecular formula C11H17N3O3S and a molecular weight of 271.34 g/mol. Its IUPAC name is 2-(methylamino)-N-(oxolan-2-ylmethyl)pyridine-4-sulfonamide.
| Compound Name | 2-(methylamino)-N-(oxolan-2-ylmethyl)pyridine-4-sulfonamide |
|---|---|
| PubChem CID | 55043942 |
| Molecular Formula | C11H17N3O3S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 2-(methylamino)-N-(oxolan-2-ylmethyl)pyridine-4-sulfonamide |
| SMILES | CNc1cc(S(=O)(=O)NCC2CCCO2)ccn1 |
| InChI | InChI=1S/C11H17N3O3S/c1-12-11-7-10(4-5-13-11)18(15,16)14-8-9-3-2-6-17-9/h4-5,7,9,14H,2-3,6,8H2,1H3,(H,12,13) |
| InChIKey | NAFIZISSTAYRTQ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |