C15H20FNO — CID 55050971
1-[[(3-fluorophenyl)methyl-methylamino]methyl]cyclopentane-1-carbaldehyde (PubChem CID 55050971) has the molecular formula C15H20FNO and a molecular weight of 249.33 g/mol. Its IUPAC name is 1-[[(3-fluorophenyl)methyl-methylamino]methyl]cyclopentane-1-carbaldehyde.
| Compound Name | 1-[[(3-fluorophenyl)methyl-methylamino]methyl]cyclopentane-1-carbaldehyde |
|---|---|
| PubChem CID | 55050971 |
| Molecular Formula | C15H20FNO |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 1-[[(3-fluorophenyl)methyl-methylamino]methyl]cyclopentane-1-carbaldehyde |
| SMILES | CN(Cc1cccc(F)c1)CC1(C=O)CCCC1 |
| InChI | InChI=1S/C15H20FNO/c1-17(10-13-5-4-6-14(16)9-13)11-15(12-18)7-2-3-8-15/h4-6,9,12H,2-3,7-8,10-11H2,1H3 |
| InChIKey | VVINMEDWXKTEMA-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|