C13H22N2O2S — CID 55071202
2-[1-(3-methylbutyl)-3-propan-2-ylpyrazol-5-yl]sulfanylacetic acid (PubChem CID 55071202) has the molecular formula C13H22N2O2S and a molecular weight of 270.40 g/mol. Its IUPAC name is 2-[1-(3-methylbutyl)-3-propan-2-ylpyrazol-5-yl]sulfanylacetic acid.
| Compound Name | 2-[1-(3-methylbutyl)-3-propan-2-ylpyrazol-5-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 55071202 |
| Molecular Formula | C13H22N2O2S |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 2-[1-(3-methylbutyl)-3-propan-2-ylpyrazol-5-yl]sulfanylacetic acid |
| SMILES | CC(C)CCn1nc(C(C)C)cc1SCC(=O)O |
| InChI | InChI=1S/C13H22N2O2S/c1-9(2)5-6-15-12(18-8-13(16)17)7-11(14-15)10(3)4/h7,9-10H,5-6,8H2,1-4H3,(H,16,17) |
| InChIKey | VYSAHEAKCIQJBI-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |