C12H11BrN4O2 — CID 55071636
3-[[4-(2-bromoethyl)triazol-1-yl]methyl]-5-(furan-2-yl)-1,2-oxazole (PubChem CID 55071636) has the molecular formula C12H11BrN4O2 and a molecular weight of 323.15 g/mol. Its IUPAC name is 3-[[4-(2-bromoethyl)triazol-1-yl]methyl]-5-(furan-2-yl)-1,2-oxazole.
| Compound Name | 3-[[4-(2-bromoethyl)triazol-1-yl]methyl]-5-(furan-2-yl)-1,2-oxazole |
|---|---|
| PubChem CID | 55071636 |
| Molecular Formula | C12H11BrN4O2 |
| Molecular Weight | 323.15 g/mol |
| Exact Mass | 322.01 |
| IUPAC Name | 3-[[4-(2-bromoethyl)triazol-1-yl]methyl]-5-(furan-2-yl)-1,2-oxazole |
| SMILES | BrCCc1cn(Cc2cc(-c3ccco3)on2)nn1 |
| InChI | InChI=1S/C12H11BrN4O2/c13-4-3-9-7-17(16-14-9)8-10-6-12(19-15-10)11-2-1-5-18-11/h1-2,5-7H,3-4,8H2 |
| InChIKey | BNFNAKGJFRDCRJ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 69.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.15 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|