C15H28N2O — CID 55072134
N-[[2-(methylaminomethyl)furan-3-yl]methyl]-N-propan-2-ylpentan-1-amine (PubChem CID 55072134) has the molecular formula C15H28N2O and a molecular weight of 252.40 g/mol. Its IUPAC name is N-[[2-(methylaminomethyl)furan-3-yl]methyl]-N-propan-2-ylpentan-1-amine.
| Compound Name | N-[[2-(methylaminomethyl)furan-3-yl]methyl]-N-propan-2-ylpentan-1-amine |
|---|---|
| PubChem CID | 55072134 |
| Molecular Formula | C15H28N2O |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.22 |
| IUPAC Name | N-[[2-(methylaminomethyl)furan-3-yl]methyl]-N-propan-2-ylpentan-1-amine |
| SMILES | CCCCCN(Cc1ccoc1CNC)C(C)C |
| InChI | InChI=1S/C15H28N2O/c1-5-6-7-9-17(13(2)3)12-14-8-10-18-15(14)11-16-4/h8,10,13,16H,5-7,9,11-12H2,1-4H3 |
| InChIKey | UYQWNZJXDGLAHV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|