C14H18N2O — CID 55074123
N-[[4-(aminomethyl)furan-2-yl]methyl]-N,4-dimethylaniline (PubChem CID 55074123) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is N-[[4-(aminomethyl)furan-2-yl]methyl]-N,4-dimethylaniline.
| Compound Name | N-[[4-(aminomethyl)furan-2-yl]methyl]-N,4-dimethylaniline |
|---|---|
| PubChem CID | 55074123 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | N-[[4-(aminomethyl)furan-2-yl]methyl]-N,4-dimethylaniline |
| SMILES | Cc1ccc(N(C)Cc2cc(CN)co2)cc1 |
| InChI | InChI=1S/C14H18N2O/c1-11-3-5-13(6-4-11)16(2)9-14-7-12(8-15)10-17-14/h3-7,10H,8-9,15H2,1-2H3 |
| InChIKey | AQTDUIVUKIPHHK-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 42.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|