C12H15ClN2OS — CID 55073926
[5-[[(5-chlorothiophen-2-yl)methyl-methylamino]methyl]furan-3-yl]methanamine (PubChem CID 55073926) has the molecular formula C12H15ClN2OS and a molecular weight of 270.79 g/mol. Its IUPAC name is [5-[[(5-chlorothiophen-2-yl)methyl-methylamino]methyl]furan-3-yl]methanamine.
| Compound Name | [5-[[(5-chlorothiophen-2-yl)methyl-methylamino]methyl]furan-3-yl]methanamine |
|---|---|
| PubChem CID | 55073926 |
| Molecular Formula | C12H15ClN2OS |
| Molecular Weight | 270.79 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | [5-[[(5-chlorothiophen-2-yl)methyl-methylamino]methyl]furan-3-yl]methanamine |
| SMILES | CN(Cc1cc(CN)co1)Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C12H15ClN2OS/c1-15(7-11-2-3-12(13)17-11)6-10-4-9(5-14)8-16-10/h2-4,8H,5-7,14H2,1H3 |
| InChIKey | IEMJKUVUTLVFOY-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 42.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.79 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |