C16H26N2 — CID 55085658
N-[2-(3,4-dihydro-2H-quinolin-1-yl)ethyl]pentan-2-amine (PubChem CID 55085658) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is N-[2-(3,4-dihydro-2H-quinolin-1-yl)ethyl]pentan-2-amine.
| Compound Name | N-[2-(3,4-dihydro-2H-quinolin-1-yl)ethyl]pentan-2-amine |
|---|---|
| PubChem CID | 55085658 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | N-[2-(3,4-dihydro-2H-quinolin-1-yl)ethyl]pentan-2-amine |
| SMILES | CCCC(C)NCCN1CCCc2ccccc21 |
| InChI | InChI=1S/C16H26N2/c1-3-7-14(2)17-11-13-18-12-6-9-15-8-4-5-10-16(15)18/h4-5,8,10,14,17H,3,6-7,9,11-13H2,1-2H3 |
| InChIKey | JDURPKNZPIWOMS-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |