2-[[2-(2,5-dimethylphenyl)acetyl]-methylamino]butanoic acid

C15H21NO3 — CID 55086579

IUPAC2-[[2-(2,5-dimethylphenyl)acetyl]-methylamino]butanoic acid
SMILESCCC(C(=O)O)N(C)C(=O)Cc1cc(C)ccc1C
InChIInChI=1S/C15H21NO3/c1-5-13(15(18)19)16(4)14(17)9-12-8-10(2)6-7-11(12)3/h6-8,13H,5,9H2,1-4H3,(H,18,19)
InChIKeyNVDLDXGYIKERPA-UHFFFAOYSA-N
MW263.34 g/mol
LogP2.17
Rot. Bonds5

About 2-[[2-(2,5-dimethylphenyl)acetyl]-methylamino]butanoic acid

2-[[2-(2,5-dimethylphenyl)acetyl]-methylamino]butanoic acid (PubChem CID 55086579) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is 2-[[2-(2,5-dimethylphenyl)acetyl]-methylamino]butanoic acid.

Molecular Properties

Compound Name2-[[2-(2,5-dimethylphenyl)acetyl]-methylamino]butanoic acid
PubChem CID55086579
Molecular FormulaC15H21NO3
Molecular Weight263.34 g/mol
Exact Mass263.15
IUPAC Name2-[[2-(2,5-dimethylphenyl)acetyl]-methylamino]butanoic acid
SMILESCCC(C(=O)O)N(C)C(=O)Cc1cc(C)ccc1C
InChIInChI=1S/C15H21NO3/c1-5-13(15(18)19)16(4)14(17)9-12-8-10(2)6-7-11(12)3/h6-8,13H,5,9H2,1-4H3,(H,18,19)
InChIKeyNVDLDXGYIKERPA-UHFFFAOYSA-N
XLogP2.17
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.34
LogP ≤ 52.17
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-[[2-(2,5-dimethylphenyl)acetyl]-methylamino]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[[2-(2,5-dimethylphenyl)acetyl]-methylamino]butanoic acid?
The IUPAC name of 2-[[2-(2,5-dimethylphenyl)acetyl]-methylamino]butanoic acid (CID 55086579) is 2-[[2-(2,5-dimethylphenyl)acetyl]-methylamino]butanoic acid.
What is the SMILES notation for 2-[[2-(2,5-dimethylphenyl)acetyl]-methylamino]butanoic acid?
The canonical SMILES for 2-[[2-(2,5-dimethylphenyl)acetyl]-methylamino]butanoic acid is CCC(C(=O)O)N(C)C(=O)Cc1cc(C)ccc1C.
What is the InChIKey of 2-[[2-(2,5-dimethylphenyl)acetyl]-methylamino]butanoic acid?
The InChIKey is NVDLDXGYIKERPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO3/c1-5-13(15(18)19)16(4)14(17)9-12-8-10(2)6-7-11(12)3/h6-8,13H,5,9H2,1-4H3,(H,18,19).
What are the key properties of 2-[[2-(2,5-dimethylphenyl)acetyl]-methylamino]butanoic acid?
2-[[2-(2,5-dimethylphenyl)acetyl]-methylamino]butanoic acid has a molecular weight of 263.34 g/mol, XLogP of 2.17, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-(2,5-dimethylphenyl)acetyl]-methylamino]butanoic acid is sourced from PubChem (CID 55086579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).