2-[(2,5-dimethylphenyl)methoxy]butanoic acid

C13H18O3 — CID 91576786

IUPAC2-[(2,5-dimethylphenyl)methoxy]butanoic acid
SMILESCCC(OCc1cc(C)ccc1C)C(=O)O
InChIInChI=1S/C13H18O3/c1-4-12(13(14)15)16-8-11-7-9(2)5-6-10(11)3/h5-7,12H,4,8H2,1-3H3,(H,14,15)
InChIKeyRFSBGLRQIFLRIR-UHFFFAOYSA-N
MW222.28 g/mol
LogP2.68
Rot. Bonds5

About 2-[(2,5-dimethylphenyl)methoxy]butanoic acid

2-[(2,5-dimethylphenyl)methoxy]butanoic acid (PubChem CID 91576786) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is 2-[(2,5-dimethylphenyl)methoxy]butanoic acid.

Molecular Properties

Compound Name2-[(2,5-dimethylphenyl)methoxy]butanoic acid
PubChem CID91576786
Molecular FormulaC13H18O3
Molecular Weight222.28 g/mol
Exact Mass222.13
IUPAC Name2-[(2,5-dimethylphenyl)methoxy]butanoic acid
SMILESCCC(OCc1cc(C)ccc1C)C(=O)O
InChIInChI=1S/C13H18O3/c1-4-12(13(14)15)16-8-11-7-9(2)5-6-10(11)3/h5-7,12H,4,8H2,1-3H3,(H,14,15)
InChIKeyRFSBGLRQIFLRIR-UHFFFAOYSA-N
XLogP2.68
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500222.28
LogP ≤ 52.68
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-[(2,5-dimethylphenyl)methoxy]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(2,5-dimethylphenyl)methoxy]butanoic acid?
The IUPAC name of 2-[(2,5-dimethylphenyl)methoxy]butanoic acid (CID 91576786) is 2-[(2,5-dimethylphenyl)methoxy]butanoic acid.
What is the SMILES notation for 2-[(2,5-dimethylphenyl)methoxy]butanoic acid?
The canonical SMILES for 2-[(2,5-dimethylphenyl)methoxy]butanoic acid is CCC(OCc1cc(C)ccc1C)C(=O)O.
What is the InChIKey of 2-[(2,5-dimethylphenyl)methoxy]butanoic acid?
The InChIKey is RFSBGLRQIFLRIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O3/c1-4-12(13(14)15)16-8-11-7-9(2)5-6-10(11)3/h5-7,12H,4,8H2,1-3H3,(H,14,15).
What are the key properties of 2-[(2,5-dimethylphenyl)methoxy]butanoic acid?
2-[(2,5-dimethylphenyl)methoxy]butanoic acid has a molecular weight of 222.28 g/mol, XLogP of 2.68, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,5-dimethylphenyl)methoxy]butanoic acid is sourced from PubChem (CID 91576786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).