C13H24N4O2 — CID 55103665
4-amino-N,N-bis(3-methylbutyl)-1,2,5-oxadiazole-3-carboxamide (PubChem CID 55103665) has the molecular formula C13H24N4O2 and a molecular weight of 268.36 g/mol. Its IUPAC name is 4-amino-N,N-bis(3-methylbutyl)-1,2,5-oxadiazole-3-carboxamide.
| Compound Name | 4-amino-N,N-bis(3-methylbutyl)-1,2,5-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 55103665 |
| Molecular Formula | C13H24N4O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | 4-amino-N,N-bis(3-methylbutyl)-1,2,5-oxadiazole-3-carboxamide |
| SMILES | CC(C)CCN(CCC(C)C)C(=O)c1nonc1N |
| InChI | InChI=1S/C13H24N4O2/c1-9(2)5-7-17(8-6-10(3)4)13(18)11-12(14)16-19-15-11/h9-10H,5-8H2,1-4H3,(H2,14,16) |
| InChIKey | LQEGEJFAEOBGKJ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |