C15H28N4O2 — CID 62687260
4-amino-N,N-dihexyl-1,2,5-oxadiazole-3-carboxamide (PubChem CID 62687260) has the molecular formula C15H28N4O2 and a molecular weight of 296.41 g/mol. Its IUPAC name is 4-amino-N,N-dihexyl-1,2,5-oxadiazole-3-carboxamide.
| Compound Name | 4-amino-N,N-dihexyl-1,2,5-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 62687260 |
| Molecular Formula | C15H28N4O2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | 4-amino-N,N-dihexyl-1,2,5-oxadiazole-3-carboxamide |
| SMILES | CCCCCCN(CCCCCC)C(=O)c1nonc1N |
| InChI | InChI=1S/C15H28N4O2/c1-3-5-7-9-11-19(12-10-8-6-4-2)15(20)13-14(16)18-21-17-13/h3-12H2,1-2H3,(H2,16,18) |
| InChIKey | NFTCSELYRWDVSI-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|