C15H13ClO2S — CID 55106047
2-chloro-6-(2,5-dimethylphenyl)sulfanylbenzoic acid (PubChem CID 55106047) has the molecular formula C15H13ClO2S and a molecular weight of 292.79 g/mol. Its IUPAC name is 2-chloro-6-(2,5-dimethylphenyl)sulfanylbenzoic acid.
| Compound Name | 2-chloro-6-(2,5-dimethylphenyl)sulfanylbenzoic acid |
|---|---|
| PubChem CID | 55106047 |
| Molecular Formula | C15H13ClO2S |
| Molecular Weight | 292.79 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | 2-chloro-6-(2,5-dimethylphenyl)sulfanylbenzoic acid |
| SMILES | Cc1ccc(C)c(Sc2cccc(Cl)c2C(=O)O)c1 |
| InChI | InChI=1S/C15H13ClO2S/c1-9-6-7-10(2)13(8-9)19-12-5-3-4-11(16)14(12)15(17)18/h3-8H,1-2H3,(H,17,18) |
| InChIKey | VCAQEBAFACBYJQ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.79 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |