About 9-(4-tert-butyl-1,3-thiazol-2-yl)-9-azabicyclo[3.3.1]nonan-3-one
9-(4-tert-butyl-1,3-thiazol-2-yl)-9-azabicyclo[3.3.1]nonan-3-one (PubChem CID 55106169) has the molecular formula C15H22N2OS
and a molecular weight of 278.42 g/mol. Its IUPAC name is 9-(4-tert-butyl-1,3-thiazol-2-yl)-9-azabicyclo[3.3.1]nonan-3-one.
Molecular Properties
| Compound Name | 9-(4-tert-butyl-1,3-thiazol-2-yl)-9-azabicyclo[3.3.1]nonan-3-one |
| PubChem CID | 55106169 |
| Molecular Formula | C15H22N2OS |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 9-(4-tert-butyl-1,3-thiazol-2-yl)-9-azabicyclo[3.3.1]nonan-3-one |
| SMILES | CC(C)(C)c1csc(N2C3CCCC2CC(=O)C3)n1 |
| InChI | InChI=1S/C15H22N2OS/c1-15(2,3)13-9-19-14(16-13)17-10-5-4-6-11(17)8-12(18)7-10/h9-11H,4-8H2,1-3H3 |
| InChIKey | SMNWXZQYRJGVKW-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 9-(4-tert-butyl-1,3-thiazol-2-yl)-9-azabicyclo[3.3.1]nonan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(4-tert-butyl-1,3-thiazol-2-yl)-9-azabicyclo[3.3.1]nonan-3-one?
The IUPAC name of 9-(4-tert-butyl-1,3-thiazol-2-yl)-9-azabicyclo[3.3.1]nonan-3-one (CID 55106169) is 9-(4-tert-butyl-1,3-thiazol-2-yl)-9-azabicyclo[3.3.1]nonan-3-one.
What is the SMILES notation for 9-(4-tert-butyl-1,3-thiazol-2-yl)-9-azabicyclo[3.3.1]nonan-3-one?
The canonical SMILES for 9-(4-tert-butyl-1,3-thiazol-2-yl)-9-azabicyclo[3.3.1]nonan-3-one is CC(C)(C)c1csc(N2C3CCCC2CC(=O)C3)n1.
What is the InChIKey of 9-(4-tert-butyl-1,3-thiazol-2-yl)-9-azabicyclo[3.3.1]nonan-3-one?
The InChIKey is SMNWXZQYRJGVKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2OS/c1-15(2,3)13-9-19-14(16-13)17-10-5-4-6-11(17)8-12(18)7-10/h9-11H,4-8H2,1-3H3.
What are the key properties of 9-(4-tert-butyl-1,3-thiazol-2-yl)-9-azabicyclo[3.3.1]nonan-3-one?
9-(4-tert-butyl-1,3-thiazol-2-yl)-9-azabicyclo[3.3.1]nonan-3-one has a molecular weight of 278.42 g/mol, XLogP of 3.53, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(4-tert-butyl-1,3-thiazol-2-yl)-9-azabicyclo[3.3.1]nonan-3-one is sourced from PubChem (CID 55106169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).