C14H24N4 — CID 55107637
2-[2-(4-cyclopentyl-1,2,4-triazol-3-yl)ethyl]piperidine (PubChem CID 55107637) has the molecular formula C14H24N4 and a molecular weight of 248.37 g/mol. Its IUPAC name is 2-[2-(4-cyclopentyl-1,2,4-triazol-3-yl)ethyl]piperidine.
| Compound Name | 2-[2-(4-cyclopentyl-1,2,4-triazol-3-yl)ethyl]piperidine |
|---|---|
| PubChem CID | 55107637 |
| Molecular Formula | C14H24N4 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.20 |
| IUPAC Name | 2-[2-(4-cyclopentyl-1,2,4-triazol-3-yl)ethyl]piperidine |
| SMILES | c1nnc(CCC2CCCCN2)n1C1CCCC1 |
| InChI | InChI=1S/C14H24N4/c1-2-7-13(6-1)18-11-16-17-14(18)9-8-12-5-3-4-10-15-12/h11-13,15H,1-10H2 |
| InChIKey | IMQFWGZLFCHRBI-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |