C12H14FN3O — CID 55114838
3-fluoro-4-methoxy-N-[(2-methyl-1H-imidazol-5-yl)methyl]aniline (PubChem CID 55114838) has the molecular formula C12H14FN3O and a molecular weight of 235.26 g/mol. Its IUPAC name is 3-fluoro-4-methoxy-N-[(2-methyl-1H-imidazol-5-yl)methyl]aniline.
| Compound Name | 3-fluoro-4-methoxy-N-[(2-methyl-1H-imidazol-5-yl)methyl]aniline |
|---|---|
| PubChem CID | 55114838 |
| Molecular Formula | C12H14FN3O |
| Molecular Weight | 235.26 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 3-fluoro-4-methoxy-N-[(2-methyl-1H-imidazol-5-yl)methyl]aniline |
| SMILES | COc1ccc(NCc2cnc(C)[nH]2)cc1F |
| InChI | InChI=1S/C12H14FN3O/c1-8-14-6-10(16-8)7-15-9-3-4-12(17-2)11(13)5-9/h3-6,15H,7H2,1-2H3,(H,14,16) |
| InChIKey | BDOBCYODFOCXIZ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.26 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|