C14H18ClN3O — CID 55114654
3-chloro-N-[(2-methyl-1H-imidazol-5-yl)methyl]-4-propoxyaniline (PubChem CID 55114654) has the molecular formula C14H18ClN3O and a molecular weight of 279.77 g/mol. Its IUPAC name is 3-chloro-N-[(2-methyl-1H-imidazol-5-yl)methyl]-4-propoxyaniline.
| Compound Name | 3-chloro-N-[(2-methyl-1H-imidazol-5-yl)methyl]-4-propoxyaniline |
|---|---|
| PubChem CID | 55114654 |
| Molecular Formula | C14H18ClN3O |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 3-chloro-N-[(2-methyl-1H-imidazol-5-yl)methyl]-4-propoxyaniline |
| SMILES | CCCOc1ccc(NCc2cnc(C)[nH]2)cc1Cl |
| InChI | InChI=1S/C14H18ClN3O/c1-3-6-19-14-5-4-11(7-13(14)15)17-9-12-8-16-10(2)18-12/h4-5,7-8,17H,3,6,9H2,1-2H3,(H,16,18) |
| InChIKey | LAOHGDDHQKKQAN-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|