C13H18N4OS — CID 55126608
2-methyl-2-(methylamino)-3-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]propanamide (PubChem CID 55126608) has the molecular formula C13H18N4OS and a molecular weight of 278.38 g/mol. Its IUPAC name is 2-methyl-2-(methylamino)-3-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]propanamide.
| Compound Name | 2-methyl-2-(methylamino)-3-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 55126608 |
| Molecular Formula | C13H18N4OS |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 2-methyl-2-(methylamino)-3-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]propanamide |
| SMILES | CNC(C)(CSc1nc2ccc(C)cc2[nH]1)C(N)=O |
| InChI | InChI=1S/C13H18N4OS/c1-8-4-5-9-10(6-8)17-12(16-9)19-7-13(2,15-3)11(14)18/h4-6,15H,7H2,1-3H3,(H2,14,18)(H,16,17) |
| InChIKey | PISIVQQZHCLTAT-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |