C14H13Cl2FN2 — CID 55127157
N-[(3,6-dichloro-2-pyridinyl)methyl]-N-ethyl-4-fluoroaniline (PubChem CID 55127157) has the molecular formula C14H13Cl2FN2 and a molecular weight of 299.18 g/mol. Its IUPAC name is N-[(3,6-dichloro-2-pyridinyl)methyl]-N-ethyl-4-fluoroaniline.
| Compound Name | N-[(3,6-dichloro-2-pyridinyl)methyl]-N-ethyl-4-fluoroaniline |
|---|---|
| PubChem CID | 55127157 |
| Molecular Formula | C14H13Cl2FN2 |
| Molecular Weight | 299.18 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | N-[(3,6-dichloro-2-pyridinyl)methyl]-N-ethyl-4-fluoroaniline |
| SMILES | CCN(Cc1nc(Cl)ccc1Cl)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H13Cl2FN2/c1-2-19(11-5-3-10(17)4-6-11)9-13-12(15)7-8-14(16)18-13/h3-8H,2,9H2,1H3 |
| InChIKey | ZIXNBOFWMNFANO-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.18 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|