C10H9ClN4O2 — CID 55127737
1-[(6-amino-3-chloro-2-pyridinyl)methyl]pyrimidine-2,4-dione (PubChem CID 55127737) has the molecular formula C10H9ClN4O2 and a molecular weight of 252.66 g/mol. Its IUPAC name is 1-[(6-amino-3-chloro-2-pyridinyl)methyl]pyrimidine-2,4-dione.
| Compound Name | 1-[(6-amino-3-chloro-2-pyridinyl)methyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 55127737 |
| Molecular Formula | C10H9ClN4O2 |
| Molecular Weight | 252.66 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | 1-[(6-amino-3-chloro-2-pyridinyl)methyl]pyrimidine-2,4-dione |
| SMILES | Nc1ccc(Cl)c(Cn2ccc(=O)[nH]c2=O)n1 |
| InChI | InChI=1S/C10H9ClN4O2/c11-6-1-2-8(12)13-7(6)5-15-4-3-9(16)14-10(15)17/h1-4H,5H2,(H2,12,13)(H,14,16,17) |
| InChIKey | VZLMZYIQMCIJJQ-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 93.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.66 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |