C14H19F2NOS — CID 55129593
N-[1-[2-(difluoromethoxy)phenyl]ethyl]thian-3-amine (PubChem CID 55129593) has the molecular formula C14H19F2NOS and a molecular weight of 287.37 g/mol. Its IUPAC name is N-[1-[2-(difluoromethoxy)phenyl]ethyl]thian-3-amine.
| Compound Name | N-[1-[2-(difluoromethoxy)phenyl]ethyl]thian-3-amine |
|---|---|
| PubChem CID | 55129593 |
| Molecular Formula | C14H19F2NOS |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | N-[1-[2-(difluoromethoxy)phenyl]ethyl]thian-3-amine |
| SMILES | CC(NC1CCCSC1)c1ccccc1OC(F)F |
| InChI | InChI=1S/C14H19F2NOS/c1-10(17-11-5-4-8-19-9-11)12-6-2-3-7-13(12)18-14(15)16/h2-3,6-7,10-11,14,17H,4-5,8-9H2,1H3 |
| InChIKey | SJQPLBWGLIQVQJ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |