C16H23F2NOS — CID 79953641
N-[1-[2-(difluoromethoxy)phenyl]ethyl]-5,5-dimethylthian-3-amine (PubChem CID 79953641) has the molecular formula C16H23F2NOS and a molecular weight of 315.43 g/mol. Its IUPAC name is N-[1-[2-(difluoromethoxy)phenyl]ethyl]-5,5-dimethylthian-3-amine.
| Compound Name | N-[1-[2-(difluoromethoxy)phenyl]ethyl]-5,5-dimethylthian-3-amine |
|---|---|
| PubChem CID | 79953641 |
| Molecular Formula | C16H23F2NOS |
| Molecular Weight | 315.43 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | N-[1-[2-(difluoromethoxy)phenyl]ethyl]-5,5-dimethylthian-3-amine |
| SMILES | CC(NC1CSCC(C)(C)C1)c1ccccc1OC(F)F |
| InChI | InChI=1S/C16H23F2NOS/c1-11(19-12-8-16(2,3)10-21-9-12)13-6-4-5-7-14(13)20-15(17)18/h4-7,11-12,15,19H,8-10H2,1-3H3 |
| InChIKey | JMPCQAQMEVYQSX-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.43 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |